| Name |
methyl 3-formyl-5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylate
|
| Molecular Formula |
C9H11N3O3
|
| Molecular Weight |
209.20
|
| Smiles |
COC(=O)C1CCc2nnc(C=O)n2C1
|
COC(=O)C1CCc2nnc(C=O)n2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.