| Name |
5-{[2-Chloro-4-(2,2,2-trifluoroacetamido)phenoxy]methyl}furan-2-carboxylic acid
|
| Molecular Formula |
C14H9ClF3NO5
|
| Molecular Weight |
363.67
|
| Smiles |
O=C(O)c1ccc(COc2ccc(NC(=O)C(F)(F)F)cc2Cl)o1
|
O=C(O)c1ccc(COc2ccc(NC(=O)C(F)(F)F)cc2Cl)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.