| Name |
benzyl N-{8-bromoimidazo[1,2-a]pyridin-3-yl}carbamate
|
| Molecular Formula |
C15H12BrN3O2
|
| Molecular Weight |
346.18
|
| Smiles |
O=C(Nc1cnc2c(Br)cccn12)OCc1ccccc1
|
O=C(Nc1cnc2c(Br)cccn12)OCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.