| Name |
rac-(2R,5R)-5-cyclopropyl-1-{[(9H-fluoren-9-yl)methoxy]carbonyl}pyrrolidine-2-carboxylic acid
|
| Molecular Formula |
C23H23NO4
|
| Molecular Weight |
377.4
|
| Smiles |
O=C(O)C1CCC(C2CC2)N1C(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)C1CCC(C2CC2)N1C(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.