| Name |
3,5-dichloro-4-{1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl}aniline
|
| Molecular Formula |
C13H11Cl2N3S
|
| Molecular Weight |
312.2
|
| Smiles |
Cc1nn(C)c2sc(-c3c(Cl)cc(N)cc3Cl)cc12
|
Cc1nn(C)c2sc(-c3c(Cl)cc(N)cc3Cl)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.