| Name |
Sodium;3-[3-aminopropyl(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]-2-hydroxypropane-1-sulfonate
|
| Molecular Formula |
C14H14F15N2NaO5S
|
| Molecular Weight |
630.30
|
| Smiles |
NCCCN(CC(O)CS(=O)(=O)[O-])C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+]
|
NCCCN(CC(O)CS(=O)(=O)[O-])C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.