| Name |
4-{4-amino-5,6-dimethyl-7H-pyrrolo[2,3-d]pyrimidin-7-yl}phenylsulfurofluoridate
|
| Molecular Formula |
C14H13FN4O3S
|
| Molecular Weight |
336.34
|
| Smiles |
Cc1c(C)n(-c2ccc(OS(=O)(=O)F)cc2)c2ncnc(N)c12
|
Cc1c(C)n(-c2ccc(OS(=O)(=O)F)cc2)c2ncnc(N)c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.