| Name |
rac-2-{N-benzyl-2-[(1R,2R)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)cyclohexyl]acetamido}acetic acid
|
| Molecular Formula |
C32H34N2O5
|
| Molecular Weight |
526.6
|
| Smiles |
O=C(O)CN(Cc1ccccc1)C(=O)CC1CCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)CN(Cc1ccccc1)C(=O)CC1CCCCC1NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.