| Name |
(2S,3R)-3-(benzyloxy)-2-{[1-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-methylcyclohexyl]formamido}butanoic acid
|
| Molecular Formula |
C34H38N2O6
|
| Molecular Weight |
570.7
|
| Smiles |
CC1CCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)(C(=O)NC(C(=O)O)C(C)OCc2ccccc2)C1
|
CC1CCCC(NC(=O)OCC2c3ccccc3-c3ccccc32)(C(=O)NC(C(=O)O)C(C)OCc2ccccc2)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.