| Name |
prop-2-en-1-yl N-{1H-pyrazolo[4,3-b]pyridin-7-yl}carbamate
|
| Molecular Formula |
C10H10N4O2
|
| Molecular Weight |
218.21
|
| Smiles |
C=CCOC(=O)Nc1ccnc2cn[nH]c12
|
C=CCOC(=O)Nc1ccnc2cn[nH]c12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.