| Name |
4-chloro-2-methyl-5H,6H,7H-pyrimido[4,5-b][1,4]thiazin-6-one
|
| Molecular Formula |
C7H6ClN3OS
|
| Molecular Weight |
215.66
|
| Smiles |
Cc1nc(Cl)c2c(n1)SCC(=O)N2
|
Cc1nc(Cl)c2c(n1)SCC(=O)N2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.