| Name |
Benzyl 6-bromo-2,3-dihydrospiro[indene-1,3'-pyrrolidine]-1'-carboxylate
|
| Molecular Formula |
C20H20BrNO2
|
| Molecular Weight |
386.3
|
| Smiles |
O=C(OCc1ccccc1)N1CCC2(CCc3ccc(Br)cc32)C1
|
O=C(OCc1ccccc1)N1CCC2(CCc3ccc(Br)cc32)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.