| Name |
methyl (3R)-3-(1-{[(tert-butoxy)carbonyl]amino}cyclohexyl)-3-hydroxypropanoate
|
| Molecular Formula |
C15H27NO5
|
| Molecular Weight |
301.38
|
| Smiles |
COC(=O)CC(O)C1(NC(=O)OC(C)(C)C)CCCCC1
|
COC(=O)CC(O)C1(NC(=O)OC(C)(C)C)CCCCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.