| Name |
3-{4-[(3-Methyl-1,2,4-oxadiazol-5-yl)methyl]piperazin-1-yl}-1,2-benzothiazole
|
| Molecular Formula |
C15H17N5OS
|
| Molecular Weight |
315.4
|
| Smiles |
Cc1noc(CN2CCN(c3nsc4ccccc34)CC2)n1
|
Cc1noc(CN2CCN(c3nsc4ccccc34)CC2)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.