| Name |
5-chloro-2-{4H,5H,6H,7H-furo[3,2-c]pyridin-4-yl}-1-methyl-1H-imidazole
|
| Molecular Formula |
C11H12ClN3O
|
| Molecular Weight |
237.68
|
| Smiles |
Cn1c(Cl)cnc1C1NCCc2occc21
|
Cn1c(Cl)cnc1C1NCCc2occc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.