| Name |
2,2-Dimethyl-5-(2,2,2-trifluoroacetyl)-hexahydro-[1,3]dioxolo[4,5-c]pyrrole-4-carboxylic acid
|
| Molecular Formula |
C10H12F3NO5
|
| Molecular Weight |
283.20
|
| Smiles |
CC1(C)OC2CN(C(=O)C(F)(F)F)C(C(=O)O)C2O1
|
CC1(C)OC2CN(C(=O)C(F)(F)F)C(C(=O)O)C2O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.