| Name |
tert-butyl N-(5-formyl-1,3-dimethyl-2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)carbamate
|
| Molecular Formula |
C12H17N3O5
|
| Molecular Weight |
283.28
|
| Smiles |
Cn1c(NC(=O)OC(C)(C)C)c(C=O)c(=O)n(C)c1=O
|
Cn1c(NC(=O)OC(C)(C)C)c(C=O)c(=O)n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.