| Name |
4-(dipropylamino)-4H,5H,6H,7H,8H-pyrazolo[1,5-a]azepine-2-carboxylic acid
|
| Molecular Formula |
C15H25N3O2
|
| Molecular Weight |
279.38
|
| Smiles |
CCCN(CCC)C1CCCCn2nc(C(=O)O)cc21
|
CCCN(CCC)C1CCCCn2nc(C(=O)O)cc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.