| Name |
{3-[(tert-butoxy)carbonyl]-5H,6H,7H-pyrrolo[1,2-a]imidazol-2-yl}carbamic acid
|
| Molecular Formula |
C12H17N3O4
|
| Molecular Weight |
267.28
|
| Smiles |
CC(C)(C)OC(=O)c1c(NC(=O)O)nc2n1CCC2
|
CC(C)(C)OC(=O)c1c(NC(=O)O)nc2n1CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.