| Name |
rac-(3R,4S)-3,4-dimethoxy-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxylic acid
|
| Molecular Formula |
C10H14F3NO5
|
| Molecular Weight |
285.22
|
| Smiles |
COC1CN(C(=O)C(F)(F)F)CCC1(OC)C(=O)O
|
COC1CN(C(=O)C(F)(F)F)CCC1(OC)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.