| Name |
3-{[4-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1,2,5-oxadiazol-3-yl]formamido}-2-hydroxy-2-methylpropanoic acid
|
| Molecular Formula |
C22H20N4O7
|
| Molecular Weight |
452.4
|
| Smiles |
CC(O)(CNC(=O)c1nonc1NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O
|
CC(O)(CNC(=O)c1nonc1NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.