| Name |
2-{6-Ethyl-10,13-dioxa-4,6-diazatricyclo[7.4.0.0,3,7]trideca-1(9),2,4,7-tetraen-5-yl}ethan-1-amine dihydrochloride
|
| Molecular Formula |
C13H19Cl2N3O2
|
| Molecular Weight |
320.21
|
| Smiles |
CCn1c(CCN)nc2cc3c(cc21)OCCO3.Cl.Cl
|
CCn1c(CCN)nc2cc3c(cc21)OCCO3.Cl.Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.