| Name |
2,2-difluoro-1-{5H,6H,7H,8H-imidazo[1,2-a]pyridin-2-yl}ethan-1-one
|
| Molecular Formula |
C9H10F2N2O
|
| Molecular Weight |
200.19
|
| Smiles |
O=C(c1cn2c(n1)CCCC2)C(F)F
|
O=C(c1cn2c(n1)CCCC2)C(F)F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.