| Name |
tert-butyl N-({7-methyl-4H,5H,6H,7H-thieno[2,3-c]pyridin-7-yl}methyl)carbamate
|
| Molecular Formula |
C14H22N2O2S
|
| Molecular Weight |
282.40
|
| Smiles |
CC(C)(C)OC(=O)NCC1(C)NCCc2ccsc21
|
CC(C)(C)OC(=O)NCC1(C)NCCc2ccsc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.