| Name |
4,4''-Dihydroxy-[1,1':4',1''-terphenyl]-3,3'',5,5''-tetracarbaldehyde
|
| Molecular Formula |
C22H14O6
|
| Molecular Weight |
374.3
|
| Smiles |
O=Cc1cc(-c2ccc(-c3cc(C=O)c(O)c(C=O)c3)cc2)cc(C=O)c1O
|
O=Cc1cc(-c2ccc(-c3cc(C=O)c(O)c(C=O)c3)cc2)cc(C=O)c1O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.