| Name |
4-(Benzo[d][1,3]dioxol-5-yl)-7,7-dimethyl-2-phenyl-2,3,3a,4,6,7,8,9a-octahydro-1H-pyrazolo[3,4-b]quinoline-3,5-diol
|
| Molecular Formula |
C25H27N3O4
|
| Molecular Weight |
433.5
|
| Smiles |
CC1(C)CC(=O)C2=C(C1)NC1NN(c3ccccc3)C(O)C1C2c1ccc2c(c1)OCO2
|
CC1(C)CC(=O)C2=C(C1)NC1NN(c3ccccc3)C(O)C1C2c1ccc2c(c1)OCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.