| Name |
2-{[2-(4-bromo-1,3-thiazol-2-yl)-6-{[(9H-fluoren-9-yl)methoxy]carbonyl}-6-azabicyclo[3.2.1]octan-2-yl]oxy}acetic acid
|
| Molecular Formula |
C27H25BrN2O5S
|
| Molecular Weight |
569.5
|
| Smiles |
O=C(O)COC1(c2nc(Br)cs2)CCC2CC1CN2C(=O)OCC1c2ccccc2-c2ccccc21
|
O=C(O)COC1(c2nc(Br)cs2)CCC2CC1CN2C(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.