| Name |
(2R)-2-{[5-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-1H-1,2,4-triazol-3-yl]formamido}pentanoic acid
|
| Molecular Formula |
C23H23N5O5
|
| Molecular Weight |
449.5
|
| Smiles |
CCCC(NC(=O)c1nc(NC(=O)OCC2c3ccccc3-c3ccccc32)n[nH]1)C(=O)O
|
CCCC(NC(=O)c1nc(NC(=O)OCC2c3ccccc3-c3ccccc32)n[nH]1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.