| Name |
1-Naphthalenol, 4-[2-(6-bromo-3-methyl-2,4-dinitrophenyl)diazenyl]-
|
| Molecular Formula |
C17H11BrN4O5
|
| Molecular Weight |
431.2
|
| Smiles |
Cc1c([N+](=O)[O-])cc(Br)c(N=Nc2ccc(O)c3ccccc23)c1[N+](=O)[O-]
|
Cc1c([N+](=O)[O-])cc(Br)c(N=Nc2ccc(O)c3ccccc23)c1[N+](=O)[O-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.