| Name |
rac-(5R,7R)-4-[(tert-butoxy)carbonyl]-5-methyl-7-(trifluoromethyl)-4H,5H,6H,7H-pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
|
| Molecular Formula |
C14H18F3N3O4
|
| Molecular Weight |
349.31
|
| Smiles |
CC1CC(C(F)(F)F)n2ncc(C(=O)O)c2N1C(=O)OC(C)(C)C
|
CC1CC(C(F)(F)F)n2ncc(C(=O)O)c2N1C(=O)OC(C)(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.