| Name |
3-[3,5-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]-5-fluoro-pyridine
|
| Molecular Formula |
C16H21BFN3O2
|
| Molecular Weight |
317.2
|
| Smiles |
Cc1nn(-c2cncc(F)c2)c(C)c1B1OC(C)(C)C(C)(C)O1
|
Cc1nn(-c2cncc(F)c2)c(C)c1B1OC(C)(C)C(C)(C)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.