| Name |
{4H-thiochromeno[3,4-d][1,2]oxazol-3-yl}methanesulfonyl chloride
|
| Molecular Formula |
C11H8ClNO3S2
|
| Molecular Weight |
301.8
|
| Smiles |
O=S(=O)(Cl)Cc1noc2c1CSc1ccccc1-2
|
O=S(=O)(Cl)Cc1noc2c1CSc1ccccc1-2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.