| Name |
2-({2-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-3,3,3-trifluoropropanamido}methyl)butanoic acid
|
| Molecular Formula |
C24H25F3N2O5
|
| Molecular Weight |
478.5
|
| Smiles |
CCC(CNC(=O)C(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(F)(F)F)C(=O)O
|
CCC(CNC(=O)C(CNC(=O)OCC1c2ccccc2-c2ccccc21)C(F)(F)F)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.