| Name |
8-(prop-2-enoyl)-3H,4H,5H,6H,7H,8H-pyrido[2,3-d]pyrimidin-4-one
|
| Molecular Formula |
C10H11N3O2
|
| Molecular Weight |
205.21
|
| Smiles |
C=CC(=O)N1CCCc2c1nc[nH]c2=O
|
C=CC(=O)N1CCCc2c1nc[nH]c2=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.