| Name |
5-Bromo-2-(5-{[1,2,4]triazolo[4,3-b]pyridazin-6-yl}-octahydropyrrolo[3,4-c]pyrrol-2-yl)pyridine
|
| Molecular Formula |
C16H16BrN7
|
| Molecular Weight |
386.25
|
| Smiles |
Brc1ccc(N2CC3CN(c4ccc5nncn5n4)CC3C2)nc1
|
Brc1ccc(N2CC3CN(c4ccc5nncn5n4)CC3C2)nc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.