| Name |
6,7-dihydro-5H-spiro[thieno[3,2-c]pyridine-4,3'-[1lambda6]thiolane]-1',1'-dione
|
| Molecular Formula |
C10H13NO2S2
|
| Molecular Weight |
243.4
|
| Smiles |
O=S1(=O)CCC2(C1)NCCc1sccc12
|
O=S1(=O)CCC2(C1)NCCc1sccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.