| Name |
2-{3H,4H,5H,6H,7H-imidazo[4,5-c]pyridin-4-yl}-N,N-dimethylacetamide
|
| Molecular Formula |
C10H16N4O
|
| Molecular Weight |
208.26
|
| Smiles |
CN(C)C(=O)CC1NCCc2[nH]cnc21
|
CN(C)C(=O)CC1NCCc2[nH]cnc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.