| Name |
(SP-5-13)-[(11bS)-2,6-Bis[4-(1,1-dimethylethyl)phenyl]-4-(hydroxy-|EO)dinaphtho[2,1-d:1 inverted exclamation marka,2 inverted exclamation marka-f][1,3,2]dioxaphosphepin 4-oxidato][[2,2 inverted exclamation marka-[1,2-ethanediylbis[(nitrilo-|EN)methylidyne]]bis[4,6-bis(1,1-dimethylethyl)phenolato-|EO]](2-)]manganese
|
| Molecular Formula |
C72H82MnN2O6P
|
| Molecular Weight |
1157.3
|
| Smiles |
CC(C)(C)c1cc(C=NCCN=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.CC(C)(C)c1ccc(-c2cc3ccccc3c3c2OP(=O)([O-])Oc2c(-c4ccc(C(C)(C)C)cc4)cc4ccccc4c2-3)cc1.[Mn+3]
|
CC(C)(C)c1cc(C=NCCN=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2[O-])c([O-])c(C(C)(C)C)c1.CC(C)(C)c1ccc(-c2cc3ccccc3c3c2OP(=O)([O-])Oc2c(-c4ccc(C(C)(C)C)cc4)cc4ccccc4c2-3)cc1.[Mn+3]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.