| Name |
Cholestane-3,24-diol, 5,6-dibromo-25-fluoro-, 3-acetate, (3I(2))-
|
| Molecular Formula |
C29H47Br2FO3
|
| Molecular Weight |
622.5
|
| Smiles |
CC(=O)OC1CCC2(C)C3CCC4(C)C(C(C)CCC(O)C(C)(C)F)CCC4C3CC(Br)C2(Br)C1
|
CC(=O)OC1CCC2(C)C3CCC4(C)C(C(C)CCC(O)C(C)(C)F)CCC4C3CC(Br)C2(Br)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.