| Name |
4-[(5-Methyl-2-phenyl-1,3-oxazol-4-yl)methyl]-11-oxa-8-thia-4,6-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one
|
| Molecular Formula |
C20H17N3O3S
|
| Molecular Weight |
379.4
|
| Smiles |
Cc1oc(-c2ccccc2)nc1Cn1cnc2sc3c(c2c1=O)CCOC3
|
Cc1oc(-c2ccccc2)nc1Cn1cnc2sc3c(c2c1=O)CCOC3
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.