| Name |
3-Amino-2-{6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl}-2-methylpropan-1-ol
|
| Molecular Formula |
C13H23NO
|
| Molecular Weight |
209.33
|
| Smiles |
CC(CN)(CO)C1=CCC2CC1C2(C)C
|
CC(CN)(CO)C1=CCC2CC1C2(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.