| Name |
5-(2-{[(Tert-butoxy)carbonyl]amino}-5-hydroxyphenyl)-1,2-oxazole-4-carboxylic acid
|
| Molecular Formula |
C15H16N2O6
|
| Molecular Weight |
320.30
|
| Smiles |
CC(C)(C)OC(=O)Nc1ccc(O)cc1-c1oncc1C(=O)O
|
CC(C)(C)OC(=O)Nc1ccc(O)cc1-c1oncc1C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.