| Name |
1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl (2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoate
|
| Molecular Formula |
C44H37N3O8
|
| Molecular Weight |
735.8
|
| Smiles |
O=C(NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)c2ccccc2C1=O)OCC1c2ccccc2-c2ccccc21
|
O=C(NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)ON1C(=O)c2ccccc2C1=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.