| Name |
3-tert-butyl 4-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl) (4S)-1,3-thiazolidine-3,4-dicarboxylate
|
| Molecular Formula |
C17H18N2O6S
|
| Molecular Weight |
378.4
|
| Smiles |
CC(C)(C)OC(=O)N1CSCC1C(=O)ON1C(=O)c2ccccc2C1=O
|
CC(C)(C)OC(=O)N1CSCC1C(=O)ON1C(=O)c2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.