| Name |
tert-butyl 4-{3-[({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)methyl]-2,6-dimethyl-5-[2-(trimethylsilyl)ethynyl]phenyl}piperazine-1-carboxylate
|
| Molecular Formula |
C38H47N3O4Si
|
| Molecular Weight |
637.9
|
| Smiles |
Cc1c(C#C[Si](C)(C)C)cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)c(C)c1N1CCN(C(=O)OC(C)(C)C)CC1
|
Cc1c(C#C[Si](C)(C)C)cc(CNC(=O)OCC2c3ccccc3-c3ccccc32)c(C)c1N1CCN(C(=O)OC(C)(C)C)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.