| Name |
(5-Hydroxy-10a-methoxy-4,7-dimethyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl)methyl 5-Bromonicotinate
|
| Molecular Formula |
C24H26BrN3O4
|
| Molecular Weight |
500.4
|
| Smiles |
COC12CC(COC(=O)c3cncc(Br)c3)CN(C)C1Cc1c(O)n(C)c3cccc2c13
|
COC12CC(COC(=O)c3cncc(Br)c3)CN(C)C1Cc1c(O)n(C)c3cccc2c13
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.