| Name |
3,6,9,16,19,22-Hexaoxabicyclo[22.3.1]octacosa-1(28),24,26-triene-2,10,15,23-tetrone
|
| Molecular Formula |
C22H28O10
|
| Molecular Weight |
452.5
|
| Smiles |
O=C1CCCCC(=O)OCCOCCOC(=O)c2cccc(c2)C(=O)OCCOCCO1
|
O=C1CCCCC(=O)OCCOCCOC(=O)c2cccc(c2)C(=O)OCCOCCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.