| Name |
2-((2R,4aS,7R,8S,8aS)-7-Chloro-4a,8-dimethyldecahydronaphthalen-2-yl)propan-2-ol
|
| Molecular Formula |
C15H27ClO
|
| Molecular Weight |
258.83
|
| Smiles |
CC1C(Cl)CCC2(C)CCC(C(C)(C)O)CC12
|
CC1C(Cl)CCC2(C)CCC(C(C)(C)O)CC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.