| Name |
tert-butyl 4-{[3-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-5-iodo-2,4-dimethylphenyl]methyl}piperazine-1-carboxylate
|
| Molecular Formula |
C33H38IN3O4
|
| Molecular Weight |
667.6
|
| Smiles |
Cc1c(I)cc(CN2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1NC(=O)OCC1c2ccccc2-c2ccccc21
|
Cc1c(I)cc(CN2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1NC(=O)OCC1c2ccccc2-c2ccccc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.