| Name |
2H-Naphtho[1,2-d]triazole-4,7-disulfonic acid, 2-[4-[4-[[p-(1,4-dichloro-N-methyl-6-phthalazinecarboxamido)phenyl]azo]-2-sulfostyryl]-3-sulfophenyl]-(7CI,8CI)
|
| Molecular Formula |
C40H26Cl2N8O13S4
|
| Molecular Weight |
1025.9
|
| Smiles |
CN(C(=O)c1ccc2c(Cl)nnc(Cl)c2c1)c1ccc(N=Nc2ccc(C=Cc3ccc(-n4nc5c(S(=O)(=O)O)cc6cc(S(=O)(=O)O)ccc6c5n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1
|
CN(C(=O)c1ccc2c(Cl)nnc(Cl)c2c1)c1ccc(N=Nc2ccc(C=Cc3ccc(-n4nc5c(S(=O)(=O)O)cc6cc(S(=O)(=O)O)ccc6c5n4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.